C9H8Cl2O3 — CID 101102857
(1R,3S,5R,8S)-9,9-dichloro-4,11-dioxatricyclo[6.3.0.03,5]undec-6-en-10-one (PubChem CID 101102857) has the molecular formula C9H8Cl2O3 and a molecular weight of 235.07 g/mol. Its IUPAC name is (1R,3S,5R,8S)-9,9-dichloro-4,11-dioxatricyclo[6.3.0.03,5]undec-6-en-10-one.
| Compound Name | (1R,3S,5R,8S)-9,9-dichloro-4,11-dioxatricyclo[6.3.0.03,5]undec-6-en-10-one |
|---|---|
| PubChem CID | 101102857 |
| Molecular Formula | C9H8Cl2O3 |
| Molecular Weight | 235.07 g/mol |
| Exact Mass | 233.99 |
| IUPAC Name | (1R,3S,5R,8S)-9,9-dichloro-4,11-dioxatricyclo[6.3.0.03,5]undec-6-en-10-one |
| SMILES | O=C1O[C@@H]2C[C@@H]3O[C@@H]3C=C[C@@H]2C1(Cl)Cl |
| InChI | InChI=1S/C9H8Cl2O3/c10-9(11)4-1-2-5-7(13-5)3-6(4)14-8(9)12/h1-2,4-7H,3H2/t4-,5+,6+,7-/m0/s1 |
| InChIKey | ZCZOBGLIOXGZBY-WNJXEPBRSA-N |
| XLogP | 1.43 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.07 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|