C22H24N2O4 — CID 10110306
6-(3-ethoxyphenyl)-N-(3,4,5-trimethoxyphenyl)pyridin-2-amine (PubChem CID 10110306) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is 6-(3-ethoxyphenyl)-N-(3,4,5-trimethoxyphenyl)pyridin-2-amine.
| Compound Name | 6-(3-ethoxyphenyl)-N-(3,4,5-trimethoxyphenyl)pyridin-2-amine |
|---|---|
| PubChem CID | 10110306 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 6-(3-ethoxyphenyl)-N-(3,4,5-trimethoxyphenyl)pyridin-2-amine |
| SMILES | CCOc1cccc(-c2cccc(Nc3cc(OC)c(OC)c(OC)c3)n2)c1 |
| InChI | InChI=1S/C22H24N2O4/c1-5-28-17-9-6-8-15(12-17)18-10-7-11-21(24-18)23-16-13-19(25-2)22(27-4)20(14-16)26-3/h6-14H,5H2,1-4H3,(H,23,24) |
| InChIKey | BYCAXVPZRVHCPO-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |