C23H33Cl2NO5 — CID 101103130
(2E,4E)-N-[(1R,2S,3S,5R,9S)-1,7-dichloro-2,5,9-trihydroxy-8-oxo-3-bicyclo[3.3.1]non-6-enyl]-4,6-dimethyldodeca-2,4-dienamide (PubChem CID 101103130) has the molecular formula C23H33Cl2NO5 and a molecular weight of 474.43 g/mol. Its IUPAC name is (2E,4E)-N-[(1R,2S,3S,5R,9S)-1,7-dichloro-2,5,9-trihydroxy-8-oxo-3-bicyclo[3.3.1]non-6-enyl]-4,6-dimethyldodeca-2,4-dienamide.
| Compound Name | (2E,4E)-N-[(1R,2S,3S,5R,9S)-1,7-dichloro-2,5,9-trihydroxy-8-oxo-3-bicyclo[3.3.1]non-6-enyl]-4,6-dimethyldodeca-2,4-dienamide |
|---|---|
| PubChem CID | 101103130 |
| Molecular Formula | C23H33Cl2NO5 |
| Molecular Weight | 474.43 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | (2E,4E)-N-[(1R,2S,3S,5R,9S)-1,7-dichloro-2,5,9-trihydroxy-8-oxo-3-bicyclo[3.3.1]non-6-enyl]-4,6-dimethyldodeca-2,4-dienamide |
| SMILES | CCCCCCC(C)/C=C(C)/C=C/C(=O)N[C@H]1C[C@@]2(O)C=C(Cl)C(=O)[C@](Cl)([C@H]2O)[C@H]1O |
| InChI | InChI=1S/C23H33Cl2NO5/c1-4-5-6-7-8-14(2)11-15(3)9-10-18(27)26-17-13-22(31)12-16(24)19(28)23(25,20(17)29)21(22)30/h9-12,14,17,20-21,29-31H,4-8,13H2,1-3H3,(H,26,27)/b10-9+,15-11+/t14?,17-,20-,21-,22-,23+/m0/s1 |
| InChIKey | ROUQFRRDALNYGD-YNDTVIGUSA-N |
| XLogP | 3.12 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.43 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|