C13H15NOS — CID 101103491
(7S,8aS)-7-phenyl-2,3,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]pyridin-5-one (PubChem CID 101103491) has the molecular formula C13H15NOS and a molecular weight of 233.34 g/mol. Its IUPAC name is (7S,8aS)-7-phenyl-2,3,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]pyridin-5-one.
| Compound Name | (7S,8aS)-7-phenyl-2,3,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]pyridin-5-one |
|---|---|
| PubChem CID | 101103491 |
| Molecular Formula | C13H15NOS |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | (7S,8aS)-7-phenyl-2,3,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]pyridin-5-one |
| SMILES | O=C1C[C@H](c2ccccc2)C[C@@H]2SCCN12 |
| InChI | InChI=1S/C13H15NOS/c15-12-8-11(10-4-2-1-3-5-10)9-13-14(12)6-7-16-13/h1-5,11,13H,6-9H2/t11-,13-/m0/s1 |
| InChIKey | VZXYFTFYFQCQFF-AAEUAGOBSA-N |
| XLogP | 2.47 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |