C30H21N3O4 — CID 1011037
N-[(2S)-2-anthracen-9-yl-4-oxo-1,2-dihydroquinazolin-3-yl]-1,3-benzodioxole-5-carboxamide (PubChem CID 1011037) has the molecular formula C30H21N3O4 and a molecular weight of 487.52 g/mol. Its IUPAC name is N-[(2S)-2-anthracen-9-yl-4-oxo-1,2-dihydroquinazolin-3-yl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[(2S)-2-anthracen-9-yl-4-oxo-1,2-dihydroquinazolin-3-yl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 1011037 |
| Molecular Formula | C30H21N3O4 |
| Molecular Weight | 487.52 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | N-[(2S)-2-anthracen-9-yl-4-oxo-1,2-dihydroquinazolin-3-yl]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(NN1C(=O)c2ccccc2N[C@@H]1c1c2ccccc2cc2ccccc12)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C30H21N3O4/c34-29(20-13-14-25-26(16-20)37-17-36-25)32-33-28(31-24-12-6-5-11-23(24)30(33)35)27-21-9-3-1-7-18(21)15-19-8-2-4-10-22(19)27/h1-16,28,31H,17H2,(H,32,34)/t28-/m0/s1 |
| InChIKey | FBTUROOZKKRBIG-NDEPHWFRSA-N |
| XLogP | 5.63 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.52 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|