C10H18O5 — CID 101103848
(1S,4R,5R,8S)-4-hydroperoxy-1-methoxy-4,8-dimethyl-2,3-dioxabicyclo[3.3.1]nonane (PubChem CID 101103848) has the molecular formula C10H18O5 and a molecular weight of 218.25 g/mol. Its IUPAC name is (1S,4R,5R,8S)-4-hydroperoxy-1-methoxy-4,8-dimethyl-2,3-dioxabicyclo[3.3.1]nonane.
| Compound Name | (1S,4R,5R,8S)-4-hydroperoxy-1-methoxy-4,8-dimethyl-2,3-dioxabicyclo[3.3.1]nonane |
|---|---|
| PubChem CID | 101103848 |
| Molecular Formula | C10H18O5 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | (1S,4R,5R,8S)-4-hydroperoxy-1-methoxy-4,8-dimethyl-2,3-dioxabicyclo[3.3.1]nonane |
| SMILES | CO[C@]12C[C@@H](CC[C@@H]1C)[C@](C)(OO)OO2 |
| InChI | InChI=1S/C10H18O5/c1-7-4-5-8-6-10(7,12-3)15-14-9(8,2)13-11/h7-8,11H,4-6H2,1-3H3/t7-,8+,9+,10-/m0/s1 |
| InChIKey | BOCKTWWBJPPZJV-JLIMGVALSA-N |
| XLogP | 1.93 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|