C13H23BrSi — CID 101104150
1-(3-bromopropyl)-1-but-3-enyl-2,3,6,7-tetrahydrosilepine (PubChem CID 101104150) has the molecular formula C13H23BrSi and a molecular weight of 287.32 g/mol. Its IUPAC name is 1-(3-bromopropyl)-1-but-3-enyl-2,3,6,7-tetrahydrosilepine.
| Compound Name | 1-(3-bromopropyl)-1-but-3-enyl-2,3,6,7-tetrahydrosilepine |
|---|---|
| PubChem CID | 101104150 |
| Molecular Formula | C13H23BrSi |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 1-(3-bromopropyl)-1-but-3-enyl-2,3,6,7-tetrahydrosilepine |
| SMILES | C=CCC[Si]1(CCCBr)CCC=CCC1 |
| InChI | InChI=1S/C13H23BrSi/c1-2-3-10-15(13-8-9-14)11-6-4-5-7-12-15/h2,4-5H,1,3,6-13H2 |
| InChIKey | UWMHLGIKZIBBFL-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|