C25H34O3 — CID 10110463
1,11-dihydroxy-2,10-dimethyl-2,10-diphenylundecan-6-one (PubChem CID 10110463) has the molecular formula C25H34O3 and a molecular weight of 382.54 g/mol. Its IUPAC name is 1,11-dihydroxy-2,10-dimethyl-2,10-diphenylundecan-6-one.
| Compound Name | 1,11-dihydroxy-2,10-dimethyl-2,10-diphenylundecan-6-one |
|---|---|
| PubChem CID | 10110463 |
| Molecular Formula | C25H34O3 |
| Molecular Weight | 382.54 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | 1,11-dihydroxy-2,10-dimethyl-2,10-diphenylundecan-6-one |
| SMILES | CC(CO)(CCCC(=O)CCCC(C)(CO)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H34O3/c1-24(19-26,21-11-5-3-6-12-21)17-9-15-23(28)16-10-18-25(2,20-27)22-13-7-4-8-14-22/h3-8,11-14,26-27H,9-10,15-20H2,1-2H3 |
| InChIKey | ZLSDDICVPOHWTB-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.54 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |