C45H48N6O6 — CID 101104723
1-[4-[(E)-2-[2,4,6-trinitro-3,5-bis[(E)-2-(4-piperidin-1-ylphenyl)ethenyl]phenyl]ethenyl]phenyl]piperidine (PubChem CID 101104723) has the molecular formula C45H48N6O6 and a molecular weight of 768.92 g/mol. Its IUPAC name is 1-[4-[(E)-2-[2,4,6-trinitro-3,5-bis[(E)-2-(4-piperidin-1-ylphenyl)ethenyl]phenyl]ethenyl]phenyl]piperidine.
| Compound Name | 1-[4-[(E)-2-[2,4,6-trinitro-3,5-bis[(E)-2-(4-piperidin-1-ylphenyl)ethenyl]phenyl]ethenyl]phenyl]piperidine |
|---|---|
| PubChem CID | 101104723 |
| Molecular Formula | C45H48N6O6 |
| Molecular Weight | 768.92 g/mol |
| Exact Mass | 768.36 |
| IUPAC Name | 1-[4-[(E)-2-[2,4,6-trinitro-3,5-bis[(E)-2-(4-piperidin-1-ylphenyl)ethenyl]phenyl]ethenyl]phenyl]piperidine |
| SMILES | O=[N+]([O-])c1c(/C=C/c2ccc(N3CCCCC3)cc2)c([N+](=O)[O-])c(/C=C/c2ccc(N3CCCCC3)cc2)c([N+](=O)[O-])c1/C=C/c1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C45H48N6O6/c52-49(53)43-40(25-16-34-10-19-37(20-11-34)46-28-4-1-5-29-46)44(50(54)55)42(27-18-36-14-23-39(24-15-36)48-32-8-3-9-33-48)45(51(56)57)41(43)26-17-35-12-21-38(22-13-35)47-30-6-2-7-31-47/h10-27H,1-9,28-33H2/b25-16+,26-17+,27-18+ |
| InChIKey | FFOUHDOHPMJNCS-IBYJIUFVSA-N |
| XLogP | 10.89 |
| TPSA | 139.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.92 |
| LogP ≤ 5 | 10.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|