C19H25NO5 — CID 101105016
ethyl (2R)-2-[(1S)-2-morpholin-4-yl-2-oxo-1-phenylmethoxyethyl]but-3-enoate (PubChem CID 101105016) has the molecular formula C19H25NO5 and a molecular weight of 347.41 g/mol. Its IUPAC name is ethyl (2R)-2-[(1S)-2-morpholin-4-yl-2-oxo-1-phenylmethoxyethyl]but-3-enoate.
| Compound Name | ethyl (2R)-2-[(1S)-2-morpholin-4-yl-2-oxo-1-phenylmethoxyethyl]but-3-enoate |
|---|---|
| PubChem CID | 101105016 |
| Molecular Formula | C19H25NO5 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | ethyl (2R)-2-[(1S)-2-morpholin-4-yl-2-oxo-1-phenylmethoxyethyl]but-3-enoate |
| SMILES | C=C[C@@H](C(=O)OCC)[C@H](OCc1ccccc1)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C19H25NO5/c1-3-16(19(22)24-4-2)17(18(21)20-10-12-23-13-11-20)25-14-15-8-6-5-7-9-15/h3,5-9,16-17H,1,4,10-14H2,2H3/t16-,17+/m1/s1 |
| InChIKey | QAQJDYXNCITOEG-SJORKVTESA-N |
| XLogP | 1.80 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|