C20H33P — CID 101105057
dicyclohexyl(3-cyclopenta-2,4-dien-1-ylpropyl)phosphane (PubChem CID 101105057) has the molecular formula C20H33P and a molecular weight of 304.46 g/mol. Its IUPAC name is dicyclohexyl(3-cyclopenta-2,4-dien-1-ylpropyl)phosphane.
| Compound Name | dicyclohexyl(3-cyclopenta-2,4-dien-1-ylpropyl)phosphane |
|---|---|
| PubChem CID | 101105057 |
| Molecular Formula | C20H33P |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.23 |
| IUPAC Name | dicyclohexyl(3-cyclopenta-2,4-dien-1-ylpropyl)phosphane |
| SMILES | C1=CC(CCCP(C2CCCCC2)C2CCCCC2)C=C1 |
| InChI | InChI=1S/C20H33P/c1-3-13-19(14-4-1)21(20-15-5-2-6-16-20)17-9-12-18-10-7-8-11-18/h7-8,10-11,18-20H,1-6,9,12-17H2 |
| InChIKey | AVXOUZULWUCYMZ-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|