About 9-hexyl-3,6-bis[(E)-2-pyridin-4-ylethenyl]carbazole
9-hexyl-3,6-bis[(E)-2-pyridin-4-ylethenyl]carbazole (PubChem CID 101105073) has the molecular formula C32H31N3
and a molecular weight of 457.62 g/mol. Its IUPAC name is 9-hexyl-3,6-bis[(E)-2-pyridin-4-ylethenyl]carbazole.
Molecular Properties
| Compound Name | 9-hexyl-3,6-bis[(E)-2-pyridin-4-ylethenyl]carbazole |
| PubChem CID | 101105073 |
| Molecular Formula | C32H31N3 |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.25 |
| IUPAC Name | 9-hexyl-3,6-bis[(E)-2-pyridin-4-ylethenyl]carbazole |
| SMILES | CCCCCCn1c2ccc(/C=C/c3ccncc3)cc2c2cc(/C=C/c3ccncc3)ccc21 |
| InChI | InChI=1S/C32H31N3/c1-2-3-4-5-22-35-31-12-10-27(8-6-25-14-18-33-19-15-25)23-29(31)30-24-28(11-13-32(30)35)9-7-26-16-20-34-21-17-26/h6-21,23-24H,2-5,22H2,1H3/b8-6+,9-7+ |
| InChIKey | AYJDNWICYVPBAD-CDJQDVQCSA-N |
| XLogP | 8.51 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 9-hexyl-3,6-bis[(E)-2-pyridin-4-ylethenyl]carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-hexyl-3,6-bis[(E)-2-pyridin-4-ylethenyl]carbazole?
The IUPAC name of 9-hexyl-3,6-bis[(E)-2-pyridin-4-ylethenyl]carbazole (CID 101105073) is 9-hexyl-3,6-bis[(E)-2-pyridin-4-ylethenyl]carbazole.
What is the SMILES notation for 9-hexyl-3,6-bis[(E)-2-pyridin-4-ylethenyl]carbazole?
The canonical SMILES for 9-hexyl-3,6-bis[(E)-2-pyridin-4-ylethenyl]carbazole is CCCCCCn1c2ccc(/C=C/c3ccncc3)cc2c2cc(/C=C/c3ccncc3)ccc21.
What is the InChIKey of 9-hexyl-3,6-bis[(E)-2-pyridin-4-ylethenyl]carbazole?
The InChIKey is AYJDNWICYVPBAD-CDJQDVQCSA-N. The full InChI is InChI=1S/C32H31N3/c1-2-3-4-5-22-35-31-12-10-27(8-6-25-14-18-33-19-15-25)23-29(31)30-24-28(11-13-32(30)35)9-7-26-16-20-34-21-17-26/h6-21,23-24H,2-5,22H2,1H3/b8-6+,9-7+.
What are the key properties of 9-hexyl-3,6-bis[(E)-2-pyridin-4-ylethenyl]carbazole?
9-hexyl-3,6-bis[(E)-2-pyridin-4-ylethenyl]carbazole has a molecular weight of 457.62 g/mol, XLogP of 8.51, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-hexyl-3,6-bis[(E)-2-pyridin-4-ylethenyl]carbazole is sourced from PubChem (CID 101105073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).