C25H25N3O — CID 10110513
10-(4-methoxy-2-methylphenyl)-11-methyl-2-(2-methylphenyl)-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene (PubChem CID 10110513) has the molecular formula C25H25N3O and a molecular weight of 383.50 g/mol. Its IUPAC name is 10-(4-methoxy-2-methylphenyl)-11-methyl-2-(2-methylphenyl)-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene.
| Compound Name | 10-(4-methoxy-2-methylphenyl)-11-methyl-2-(2-methylphenyl)-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene |
|---|---|
| PubChem CID | 10110513 |
| Molecular Formula | C25H25N3O |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | 10-(4-methoxy-2-methylphenyl)-11-methyl-2-(2-methylphenyl)-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene |
| SMILES | COc1ccc(-c2c(C)nn3c(-c4ccccc4C)c4c(nc23)CCC4)c(C)c1 |
| InChI | InChI=1S/C25H25N3O/c1-15-8-5-6-9-20(15)24-21-10-7-11-22(21)26-25-23(17(3)27-28(24)25)19-13-12-18(29-4)14-16(19)2/h5-6,8-9,12-14H,7,10-11H2,1-4H3 |
| InChIKey | ITLFAEVNLGSFFF-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |