C16H15Cl2N3O4 — CID 10110543
2-methoxyethyl 5-cyano-4-(3,5-dichlorophenyl)-6-methyl-2-oxo-1,4-dihydropyrimidine-3-carboxylate (PubChem CID 10110543) has the molecular formula C16H15Cl2N3O4 and a molecular weight of 384.22 g/mol. Its IUPAC name is 2-methoxyethyl 5-cyano-4-(3,5-dichlorophenyl)-6-methyl-2-oxo-1,4-dihydropyrimidine-3-carboxylate.
| Compound Name | 2-methoxyethyl 5-cyano-4-(3,5-dichlorophenyl)-6-methyl-2-oxo-1,4-dihydropyrimidine-3-carboxylate |
|---|---|
| PubChem CID | 10110543 |
| Molecular Formula | C16H15Cl2N3O4 |
| Molecular Weight | 384.22 g/mol |
| Exact Mass | 383.04 |
| IUPAC Name | 2-methoxyethyl 5-cyano-4-(3,5-dichlorophenyl)-6-methyl-2-oxo-1,4-dihydropyrimidine-3-carboxylate |
| SMILES | COCCOC(=O)N1C(=O)NC(C)=C(C#N)C1c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C16H15Cl2N3O4/c1-9-13(8-19)14(10-5-11(17)7-12(18)6-10)21(15(22)20-9)16(23)25-4-3-24-2/h5-7,14H,3-4H2,1-2H3,(H,20,22) |
| InChIKey | XAJFAGUADUCWNH-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.22 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|