C33H44O12 — CID 101105451
3,9-bis[2,5-dioxo-3,4-di(propan-2-yloxy)cyclopent-3-en-1-yl]undecane-2,4,8,10-tetrone (PubChem CID 101105451) has the molecular formula C33H44O12 and a molecular weight of 632.70 g/mol. Its IUPAC name is 3,9-bis[2,5-dioxo-3,4-di(propan-2-yloxy)cyclopent-3-en-1-yl]undecane-2,4,8,10-tetrone.
| Compound Name | 3,9-bis[2,5-dioxo-3,4-di(propan-2-yloxy)cyclopent-3-en-1-yl]undecane-2,4,8,10-tetrone |
|---|---|
| PubChem CID | 101105451 |
| Molecular Formula | C33H44O12 |
| Molecular Weight | 632.70 g/mol |
| Exact Mass | 632.28 |
| IUPAC Name | 3,9-bis[2,5-dioxo-3,4-di(propan-2-yloxy)cyclopent-3-en-1-yl]undecane-2,4,8,10-tetrone |
| SMILES | CC(=O)C(C(=O)CCCC(=O)C(C(C)=O)C1C(=O)C(OC(C)C)=C(OC(C)C)C1=O)C1C(=O)C(OC(C)C)=C(OC(C)C)C1=O |
| InChI | InChI=1S/C33H44O12/c1-14(2)42-30-26(38)24(27(39)31(30)43-15(3)4)22(18(9)34)20(36)12-11-13-21(37)23(19(10)35)25-28(40)32(44-16(5)6)33(29(25)41)45-17(7)8/h14-17,22-25H,11-13H2,1-10H3 |
| InChIKey | FPLPWCWCOCEXMA-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 173.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.70 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|