C20H21N2O4P — CID 10110549
N-hydroxy-1-oxo-1-(4-phenoxyphenyl)-4a,5,6,7-tetrahydro-2H-pyrrolo[2,1-f]azaphosphinine-7-carboxamide (PubChem CID 10110549) has the molecular formula C20H21N2O4P and a molecular weight of 384.37 g/mol. Its IUPAC name is N-hydroxy-1-oxo-1-(4-phenoxyphenyl)-4a,5,6,7-tetrahydro-2H-pyrrolo[2,1-f]azaphosphinine-7-carboxamide.
| Compound Name | N-hydroxy-1-oxo-1-(4-phenoxyphenyl)-4a,5,6,7-tetrahydro-2H-pyrrolo[2,1-f]azaphosphinine-7-carboxamide |
|---|---|
| PubChem CID | 10110549 |
| Molecular Formula | C20H21N2O4P |
| Molecular Weight | 384.37 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | N-hydroxy-1-oxo-1-(4-phenoxyphenyl)-4a,5,6,7-tetrahydro-2H-pyrrolo[2,1-f]azaphosphinine-7-carboxamide |
| SMILES | O=C(NO)C1CCC2C=CCP(=O)(c3ccc(Oc4ccccc4)cc3)N21 |
| InChI | InChI=1S/C20H21N2O4P/c23-20(21-24)19-13-8-15-5-4-14-27(25,22(15)19)18-11-9-17(10-12-18)26-16-6-2-1-3-7-16/h1-7,9-12,15,19,24H,8,13-14H2,(H,21,23) |
| InChIKey | LJJRCXILDYQJJT-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.37 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|