C22H24O6 — CID 10110559
(3,4,5-trimethoxyphenyl)methyl 2,2-dimethylchromene-6-carboxylate (PubChem CID 10110559) has the molecular formula C22H24O6 and a molecular weight of 384.43 g/mol. Its IUPAC name is (3,4,5-trimethoxyphenyl)methyl 2,2-dimethylchromene-6-carboxylate.
| Compound Name | (3,4,5-trimethoxyphenyl)methyl 2,2-dimethylchromene-6-carboxylate |
|---|---|
| PubChem CID | 10110559 |
| Molecular Formula | C22H24O6 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | (3,4,5-trimethoxyphenyl)methyl 2,2-dimethylchromene-6-carboxylate |
| SMILES | COc1cc(COC(=O)c2ccc3c(c2)C=CC(C)(C)O3)cc(OC)c1OC |
| InChI | InChI=1S/C22H24O6/c1-22(2)9-8-15-12-16(6-7-17(15)28-22)21(23)27-13-14-10-18(24-3)20(26-5)19(11-14)25-4/h6-12H,13H2,1-5H3 |
| InChIKey | KGQMIJVIIHJLMD-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |