C21H24O — CID 101105707
(1S,8S)-10,10-diphenyl-9-oxabicyclo[6.2.0]decane (PubChem CID 101105707) has the molecular formula C21H24O and a molecular weight of 292.42 g/mol. Its IUPAC name is (1S,8S)-10,10-diphenyl-9-oxabicyclo[6.2.0]decane.
| Compound Name | (1S,8S)-10,10-diphenyl-9-oxabicyclo[6.2.0]decane |
|---|---|
| PubChem CID | 101105707 |
| Molecular Formula | C21H24O |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | (1S,8S)-10,10-diphenyl-9-oxabicyclo[6.2.0]decane |
| SMILES | c1ccc(C2(c3ccccc3)O[C@H]3CCCCCC[C@@H]32)cc1 |
| InChI | InChI=1S/C21H24O/c1-2-10-16-20-19(15-9-1)21(22-20,17-11-5-3-6-12-17)18-13-7-4-8-14-18/h3-8,11-14,19-20H,1-2,9-10,15-16H2/t19-,20-/m0/s1 |
| InChIKey | FHHAGNNIRKSUOE-PMACEKPBSA-N |
| XLogP | 5.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |