C17H23NOSi — CID 101105873
(5E)-5-[phenyl(trimethylsilyl)methylidene]-2,6,7,8-tetrahydro-1H-pyrrolizin-3-one (PubChem CID 101105873) has the molecular formula C17H23NOSi and a molecular weight of 285.46 g/mol. Its IUPAC name is (5E)-5-[phenyl(trimethylsilyl)methylidene]-2,6,7,8-tetrahydro-1H-pyrrolizin-3-one.
| Compound Name | (5E)-5-[phenyl(trimethylsilyl)methylidene]-2,6,7,8-tetrahydro-1H-pyrrolizin-3-one |
|---|---|
| PubChem CID | 101105873 |
| Molecular Formula | C17H23NOSi |
| Molecular Weight | 285.46 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | (5E)-5-[phenyl(trimethylsilyl)methylidene]-2,6,7,8-tetrahydro-1H-pyrrolizin-3-one |
| SMILES | C[Si](C)(C)/C(=C1\CCC2CCC(=O)N12)c1ccccc1 |
| InChI | InChI=1S/C17H23NOSi/c1-20(2,3)17(13-7-5-4-6-8-13)15-11-9-14-10-12-16(19)18(14)15/h4-8,14H,9-12H2,1-3H3/b17-15+ |
| InChIKey | NZRDIUVKCKTGEE-BMRADRMJSA-N |
| XLogP | 4.06 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.46 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|