C22H30O3 — CID 101105926
(5'R,8R,9S,10R,13S,14S,17S)-5',13-dimethylspiro[1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,2'-oxolane]-3,3'-dione (PubChem CID 101105926) has the molecular formula C22H30O3 and a molecular weight of 342.48 g/mol. Its IUPAC name is (5'R,8R,9S,10R,13S,14S,17S)-5',13-dimethylspiro[1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,2'-oxolane]-3,3'-dione.
| Compound Name | (5'R,8R,9S,10R,13S,14S,17S)-5',13-dimethylspiro[1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,2'-oxolane]-3,3'-dione |
|---|---|
| PubChem CID | 101105926 |
| Molecular Formula | C22H30O3 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | (5'R,8R,9S,10R,13S,14S,17S)-5',13-dimethylspiro[1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,2'-oxolane]-3,3'-dione |
| SMILES | C[C@@H]1CC(=O)[C@@]2(CC[C@H]3[C@@H]4CCC5=CC(=O)CC[C@@H]5[C@H]4CC[C@@]32C)O1 |
| InChI | InChI=1S/C22H30O3/c1-13-11-20(24)22(25-13)10-8-19-18-5-3-14-12-15(23)4-6-16(14)17(18)7-9-21(19,22)2/h12-13,16-19H,3-11H2,1-2H3/t13-,16+,17-,18-,19+,21+,22-/m1/s1 |
| InChIKey | DVHOGWHHGFIZCL-XFXQXPGMSA-N |
| XLogP | 4.24 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |