C28H32O2S2 — CID 101106184
propan-2-yl 2-phenyl-7,7-bis(phenylsulfanyl)heptanoate (PubChem CID 101106184) has the molecular formula C28H32O2S2 and a molecular weight of 464.70 g/mol. Its IUPAC name is propan-2-yl 2-phenyl-7,7-bis(phenylsulfanyl)heptanoate.
| Compound Name | propan-2-yl 2-phenyl-7,7-bis(phenylsulfanyl)heptanoate |
|---|---|
| PubChem CID | 101106184 |
| Molecular Formula | C28H32O2S2 |
| Molecular Weight | 464.70 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | propan-2-yl 2-phenyl-7,7-bis(phenylsulfanyl)heptanoate |
| SMILES | CC(C)OC(=O)C(CCCCC(Sc1ccccc1)Sc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H32O2S2/c1-22(2)30-28(29)26(23-14-6-3-7-15-23)20-12-13-21-27(31-24-16-8-4-9-17-24)32-25-18-10-5-11-19-25/h3-11,14-19,22,26-27H,12-13,20-21H2,1-2H3 |
| InChIKey | IBSTZDLJLGMGRO-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.70 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|