C20H29NO7 — CID 101106389
diethyl 6,7-dimethoxy-8-propan-2-yloxy-3,4-dihydro-2H-isoquinoline-1,1-dicarboxylate (PubChem CID 101106389) has the molecular formula C20H29NO7 and a molecular weight of 395.45 g/mol. Its IUPAC name is diethyl 6,7-dimethoxy-8-propan-2-yloxy-3,4-dihydro-2H-isoquinoline-1,1-dicarboxylate.
| Compound Name | diethyl 6,7-dimethoxy-8-propan-2-yloxy-3,4-dihydro-2H-isoquinoline-1,1-dicarboxylate |
|---|---|
| PubChem CID | 101106389 |
| Molecular Formula | C20H29NO7 |
| Molecular Weight | 395.45 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | diethyl 6,7-dimethoxy-8-propan-2-yloxy-3,4-dihydro-2H-isoquinoline-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)NCCc2cc(OC)c(OC)c(OC(C)C)c21 |
| InChI | InChI=1S/C20H29NO7/c1-7-26-18(22)20(19(23)27-8-2)15-13(9-10-21-20)11-14(24-5)16(25-6)17(15)28-12(3)4/h11-12,21H,7-10H2,1-6H3 |
| InChIKey | VIJHDYWDTHETPT-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.45 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|