About 7-[(3,4-dichlorophenyl)methyl]-10H-phenoxazine-1-carboxylic acid
7-[(3,4-dichlorophenyl)methyl]-10H-phenoxazine-1-carboxylic acid (PubChem CID 10110654) has the molecular formula C20H13Cl2NO3
and a molecular weight of 386.23 g/mol. Its IUPAC name is 7-[(3,4-dichlorophenyl)methyl]-10H-phenoxazine-1-carboxylic acid.
Molecular Properties
| Compound Name | 7-[(3,4-dichlorophenyl)methyl]-10H-phenoxazine-1-carboxylic acid |
| PubChem CID | 10110654 |
| Molecular Formula | C20H13Cl2NO3 |
| Molecular Weight | 386.23 g/mol |
| Exact Mass | 385.03 |
| IUPAC Name | 7-[(3,4-dichlorophenyl)methyl]-10H-phenoxazine-1-carboxylic acid |
| SMILES | O=C(O)c1cccc2c1Nc1ccc(Cc3ccc(Cl)c(Cl)c3)cc1O2 |
| InChI | InChI=1S/C20H13Cl2NO3/c21-14-6-4-11(9-15(14)22)8-12-5-7-16-18(10-12)26-17-3-1-2-13(20(24)25)19(17)23-16/h1-7,9-10,23H,8H2,(H,24,25) |
| InChIKey | UFDVSTLREJXHOV-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.23 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-[(3,4-dichlorophenyl)methyl]-10H-phenoxazine-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[(3,4-dichlorophenyl)methyl]-10H-phenoxazine-1-carboxylic acid?
The IUPAC name of 7-[(3,4-dichlorophenyl)methyl]-10H-phenoxazine-1-carboxylic acid (CID 10110654) is 7-[(3,4-dichlorophenyl)methyl]-10H-phenoxazine-1-carboxylic acid.
What is the SMILES notation for 7-[(3,4-dichlorophenyl)methyl]-10H-phenoxazine-1-carboxylic acid?
The canonical SMILES for 7-[(3,4-dichlorophenyl)methyl]-10H-phenoxazine-1-carboxylic acid is O=C(O)c1cccc2c1Nc1ccc(Cc3ccc(Cl)c(Cl)c3)cc1O2.
What is the InChIKey of 7-[(3,4-dichlorophenyl)methyl]-10H-phenoxazine-1-carboxylic acid?
The InChIKey is UFDVSTLREJXHOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H13Cl2NO3/c21-14-6-4-11(9-15(14)22)8-12-5-7-16-18(10-12)26-17-3-1-2-13(20(24)25)19(17)23-16/h1-7,9-10,23H,8H2,(H,24,25).
What are the key properties of 7-[(3,4-dichlorophenyl)methyl]-10H-phenoxazine-1-carboxylic acid?
7-[(3,4-dichlorophenyl)methyl]-10H-phenoxazine-1-carboxylic acid has a molecular weight of 386.23 g/mol, XLogP of 6.13, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(3,4-dichlorophenyl)methyl]-10H-phenoxazine-1-carboxylic acid is sourced from PubChem (CID 10110654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).