C18H36O6 — CID 101106649
[3-(1,3-dihydroxypropan-2-yloxy)-2-hydroxypropyl] dodecanoate (PubChem CID 101106649) has the molecular formula C18H36O6 and a molecular weight of 348.48 g/mol. Its IUPAC name is [3-(1,3-dihydroxypropan-2-yloxy)-2-hydroxypropyl] dodecanoate.
| Compound Name | [3-(1,3-dihydroxypropan-2-yloxy)-2-hydroxypropyl] dodecanoate |
|---|---|
| PubChem CID | 101106649 |
| Molecular Formula | C18H36O6 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | [3-(1,3-dihydroxypropan-2-yloxy)-2-hydroxypropyl] dodecanoate |
| SMILES | CCCCCCCCCCCC(=O)OCC(O)COC(CO)CO |
| InChI | InChI=1S/C18H36O6/c1-2-3-4-5-6-7-8-9-10-11-18(22)24-15-16(21)14-23-17(12-19)13-20/h16-17,19-21H,2-15H2,1H3 |
| InChIKey | QBQVMJCZSDELFI-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|