C27H58O4Si3 — CID 101106917
[(2R,3S,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-3,4-dihydro-2H-pyran-2-yl]methoxy-tri(propan-2-yl)silane (PubChem CID 101106917) has the molecular formula C27H58O4Si3 and a molecular weight of 531.02 g/mol. Its IUPAC name is [(2R,3S,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-3,4-dihydro-2H-pyran-2-yl]methoxy-tri(propan-2-yl)silane.
| Compound Name | [(2R,3S,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-3,4-dihydro-2H-pyran-2-yl]methoxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 101106917 |
| Molecular Formula | C27H58O4Si3 |
| Molecular Weight | 531.02 g/mol |
| Exact Mass | 530.36 |
| IUPAC Name | [(2R,3S,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-3,4-dihydro-2H-pyran-2-yl]methoxy-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](OC[C@H]1OC=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C27H58O4Si3/c1-20(2)34(21(3)4,22(5)6)29-19-24-25(31-33(15,16)27(10,11)12)23(17-18-28-24)30-32(13,14)26(7,8)9/h17-18,20-25H,19H2,1-16H3/t23-,24-,25-/m1/s1 |
| InChIKey | AYBXQEIUBARTCO-UBFVSLLYSA-N |
| XLogP | 8.87 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.02 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|