C19H14N4O — CID 101107516
1-[(3E)-3-benzylidene-2-oxocyclohexyl]ethane-1,1,2,2-tetracarbonitrile (PubChem CID 101107516) has the molecular formula C19H14N4O and a molecular weight of 314.35 g/mol. Its IUPAC name is 1-[(3E)-3-benzylidene-2-oxocyclohexyl]ethane-1,1,2,2-tetracarbonitrile.
| Compound Name | 1-[(3E)-3-benzylidene-2-oxocyclohexyl]ethane-1,1,2,2-tetracarbonitrile |
|---|---|
| PubChem CID | 101107516 |
| Molecular Formula | C19H14N4O |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 1-[(3E)-3-benzylidene-2-oxocyclohexyl]ethane-1,1,2,2-tetracarbonitrile |
| SMILES | N#CC(C#N)C(C#N)(C#N)C1CCC/C(=C\c2ccccc2)C1=O |
| InChI | InChI=1S/C19H14N4O/c20-10-16(11-21)19(12-22,13-23)17-8-4-7-15(18(17)24)9-14-5-2-1-3-6-14/h1-3,5-6,9,16-17H,4,7-8H2/b15-9+ |
| InChIKey | TXKHFKYCTCHQFJ-OQLLNIDSSA-N |
| XLogP | 3.14 |
| TPSA | 112.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|