C14H14N4O2 — CID 101107534
(1S,2S,7S,9S)-1-hydroxy-10-oxo-11-azatricyclo[7.2.1.02,7]dodecane-8,8,9-tricarbonitrile (PubChem CID 101107534) has the molecular formula C14H14N4O2 and a molecular weight of 270.29 g/mol. Its IUPAC name is (1S,2S,7S,9S)-1-hydroxy-10-oxo-11-azatricyclo[7.2.1.02,7]dodecane-8,8,9-tricarbonitrile.
| Compound Name | (1S,2S,7S,9S)-1-hydroxy-10-oxo-11-azatricyclo[7.2.1.02,7]dodecane-8,8,9-tricarbonitrile |
|---|---|
| PubChem CID | 101107534 |
| Molecular Formula | C14H14N4O2 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | (1S,2S,7S,9S)-1-hydroxy-10-oxo-11-azatricyclo[7.2.1.02,7]dodecane-8,8,9-tricarbonitrile |
| SMILES | N#CC1(C#N)[C@H]2CCCC[C@@H]2[C@@]2(O)C[C@]1(C#N)C(=O)N2 |
| InChI | InChI=1S/C14H14N4O2/c15-6-12-5-14(20,18-11(12)19)10-4-2-1-3-9(10)13(12,7-16)8-17/h9-10,20H,1-5H2,(H,18,19)/t9-,10-,12-,14-/m0/s1 |
| InChIKey | SIQXNDZRPVEWMS-WRZDFSGXSA-N |
| XLogP | 0.56 |
| TPSA | 120.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |