C10H8F4N4O — CID 101107633
N-methyl-5-[2,3,5,6-tetrafluoro-4-(methylamino)phenyl]-1,2,4-oxadiazol-3-amine (PubChem CID 101107633) has the molecular formula C10H8F4N4O and a molecular weight of 276.19 g/mol. Its IUPAC name is N-methyl-5-[2,3,5,6-tetrafluoro-4-(methylamino)phenyl]-1,2,4-oxadiazol-3-amine.
| Compound Name | N-methyl-5-[2,3,5,6-tetrafluoro-4-(methylamino)phenyl]-1,2,4-oxadiazol-3-amine |
|---|---|
| PubChem CID | 101107633 |
| Molecular Formula | C10H8F4N4O |
| Molecular Weight | 276.19 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | N-methyl-5-[2,3,5,6-tetrafluoro-4-(methylamino)phenyl]-1,2,4-oxadiazol-3-amine |
| SMILES | CNc1noc(-c2c(F)c(F)c(NC)c(F)c2F)n1 |
| InChI | InChI=1S/C10H8F4N4O/c1-15-8-6(13)4(11)3(5(12)7(8)14)9-17-10(16-2)18-19-9/h15H,1-2H3,(H,16,18) |
| InChIKey | UJSKFEKZBKQZEH-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 62.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.19 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|