About (2S)-2-ethoxy-3,4-dihydro-2H-benzo[h]chromene-5,6-dione
(2S)-2-ethoxy-3,4-dihydro-2H-benzo[h]chromene-5,6-dione (PubChem CID 101107998) has the molecular formula C15H14O4
and a molecular weight of 258.27 g/mol. Its IUPAC name is (2S)-2-ethoxy-3,4-dihydro-2H-benzo[h]chromene-5,6-dione.
Molecular Properties
| Compound Name | (2S)-2-ethoxy-3,4-dihydro-2H-benzo[h]chromene-5,6-dione |
| PubChem CID | 101107998 |
| Molecular Formula | C15H14O4 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | (2S)-2-ethoxy-3,4-dihydro-2H-benzo[h]chromene-5,6-dione |
| SMILES | CCO[C@@H]1CCC2=C(O1)c1ccccc1C(=O)C2=O |
| InChI | InChI=1S/C15H14O4/c1-2-18-12-8-7-11-14(17)13(16)9-5-3-4-6-10(9)15(11)19-12/h3-6,12H,2,7-8H2,1H3/t12-/m0/s1 |
| InChIKey | PWQZZDZSGHNITN-LBPRGKRZSA-N |
| XLogP | 2.34 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-ethoxy-3,4-dihydro-2H-benzo[h]chromene-5,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-ethoxy-3,4-dihydro-2H-benzo[h]chromene-5,6-dione?
The IUPAC name of (2S)-2-ethoxy-3,4-dihydro-2H-benzo[h]chromene-5,6-dione (CID 101107998) is (2S)-2-ethoxy-3,4-dihydro-2H-benzo[h]chromene-5,6-dione.
What is the SMILES notation for (2S)-2-ethoxy-3,4-dihydro-2H-benzo[h]chromene-5,6-dione?
The canonical SMILES for (2S)-2-ethoxy-3,4-dihydro-2H-benzo[h]chromene-5,6-dione is CCO[C@@H]1CCC2=C(O1)c1ccccc1C(=O)C2=O.
What is the InChIKey of (2S)-2-ethoxy-3,4-dihydro-2H-benzo[h]chromene-5,6-dione?
The InChIKey is PWQZZDZSGHNITN-LBPRGKRZSA-N. The full InChI is InChI=1S/C15H14O4/c1-2-18-12-8-7-11-14(17)13(16)9-5-3-4-6-10(9)15(11)19-12/h3-6,12H,2,7-8H2,1H3/t12-/m0/s1.
What are the key properties of (2S)-2-ethoxy-3,4-dihydro-2H-benzo[h]chromene-5,6-dione?
(2S)-2-ethoxy-3,4-dihydro-2H-benzo[h]chromene-5,6-dione has a molecular weight of 258.27 g/mol, XLogP of 2.34, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-ethoxy-3,4-dihydro-2H-benzo[h]chromene-5,6-dione is sourced from PubChem (CID 101107998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).