C19H22BrN3O — CID 10110806
1-(2-bromophenyl)-3-[[(2S)-1-(3-methylphenyl)pyrrolidin-2-yl]methyl]urea (PubChem CID 10110806) has the molecular formula C19H22BrN3O and a molecular weight of 388.31 g/mol. Its IUPAC name is 1-(2-bromophenyl)-3-[[(2S)-1-(3-methylphenyl)pyrrolidin-2-yl]methyl]urea.
| Compound Name | 1-(2-bromophenyl)-3-[[(2S)-1-(3-methylphenyl)pyrrolidin-2-yl]methyl]urea |
|---|---|
| PubChem CID | 10110806 |
| Molecular Formula | C19H22BrN3O |
| Molecular Weight | 388.31 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 1-(2-bromophenyl)-3-[[(2S)-1-(3-methylphenyl)pyrrolidin-2-yl]methyl]urea |
| SMILES | Cc1cccc(N2CCC[C@H]2CNC(=O)Nc2ccccc2Br)c1 |
| InChI | InChI=1S/C19H22BrN3O/c1-14-6-4-7-15(12-14)23-11-5-8-16(23)13-21-19(24)22-18-10-3-2-9-17(18)20/h2-4,6-7,9-10,12,16H,5,8,11,13H2,1H3,(H2,21,22,24)/t16-/m0/s1 |
| InChIKey | HBTHELUXNSBZDM-INIZCTEOSA-N |
| XLogP | 4.55 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.31 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |