C15H21NO2 — CID 101108151
2-oxo-3-propan-2-ylidene-N,N-bis(prop-2-enyl)cyclopentane-1-carboxamide (PubChem CID 101108151) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is 2-oxo-3-propan-2-ylidene-N,N-bis(prop-2-enyl)cyclopentane-1-carboxamide.
| Compound Name | 2-oxo-3-propan-2-ylidene-N,N-bis(prop-2-enyl)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 101108151 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | 2-oxo-3-propan-2-ylidene-N,N-bis(prop-2-enyl)cyclopentane-1-carboxamide |
| SMILES | C=CCN(CC=C)C(=O)C1CCC(=C(C)C)C1=O |
| InChI | InChI=1S/C15H21NO2/c1-5-9-16(10-6-2)15(18)13-8-7-12(11(3)4)14(13)17/h5-6,13H,1-2,7-10H2,3-4H3 |
| InChIKey | MDHREXYTDDOUDN-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|