C14H20N2S4 — CID 101108238
4-N,4-N,5-N,5-N-tetramethyl-2-(4,5,6,7-tetrahydro-1,3-benzodithiol-2-ylidene)-1,3-dithiole-4,5-diamine (PubChem CID 101108238) has the molecular formula C14H20N2S4 and a molecular weight of 344.60 g/mol. Its IUPAC name is 4-N,4-N,5-N,5-N-tetramethyl-2-(4,5,6,7-tetrahydro-1,3-benzodithiol-2-ylidene)-1,3-dithiole-4,5-diamine.
| Compound Name | 4-N,4-N,5-N,5-N-tetramethyl-2-(4,5,6,7-tetrahydro-1,3-benzodithiol-2-ylidene)-1,3-dithiole-4,5-diamine |
|---|---|
| PubChem CID | 101108238 |
| Molecular Formula | C14H20N2S4 |
| Molecular Weight | 344.60 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | 4-N,4-N,5-N,5-N-tetramethyl-2-(4,5,6,7-tetrahydro-1,3-benzodithiol-2-ylidene)-1,3-dithiole-4,5-diamine |
| SMILES | CN(C)C1=C(N(C)C)SC(=C2SC3=C(CCCC3)S2)S1 |
| InChI | InChI=1S/C14H20N2S4/c1-15(2)11-12(16(3)4)20-14(19-11)13-17-9-7-5-6-8-10(9)18-13/h5-8H2,1-4H3 |
| InChIKey | MXNKCLFFQRUWQK-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.60 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |