C17H5BF10 — CID 101108535
cyclopenta-1,3-dien-1-yl-bis(2,3,4,5,6-pentafluorophenyl)borane (PubChem CID 101108535) has the molecular formula C17H5BF10 and a molecular weight of 410.02 g/mol. Its IUPAC name is cyclopenta-1,3-dien-1-yl-bis(2,3,4,5,6-pentafluorophenyl)borane.
| Compound Name | cyclopenta-1,3-dien-1-yl-bis(2,3,4,5,6-pentafluorophenyl)borane |
|---|---|
| PubChem CID | 101108535 |
| Molecular Formula | C17H5BF10 |
| Molecular Weight | 410.02 g/mol |
| Exact Mass | 410.03 |
| IUPAC Name | cyclopenta-1,3-dien-1-yl-bis(2,3,4,5,6-pentafluorophenyl)borane |
| SMILES | Fc1c(F)c(F)c(B(C2=CC=CC2)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C17H5BF10/c19-8-6(9(20)13(24)16(27)12(8)23)18(5-3-1-2-4-5)7-10(21)14(25)17(28)15(26)11(7)22/h1-3H,4H2 |
| InChIKey | CAIZVEHUVWILFV-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.02 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|