C15H19BrN2O — CID 101108562
2-bromo-N-tert-butyl-N,1-dimethylindole-3-carboxamide (PubChem CID 101108562) has the molecular formula C15H19BrN2O and a molecular weight of 323.23 g/mol. Its IUPAC name is 2-bromo-N-tert-butyl-N,1-dimethylindole-3-carboxamide.
| Compound Name | 2-bromo-N-tert-butyl-N,1-dimethylindole-3-carboxamide |
|---|---|
| PubChem CID | 101108562 |
| Molecular Formula | C15H19BrN2O |
| Molecular Weight | 323.23 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | 2-bromo-N-tert-butyl-N,1-dimethylindole-3-carboxamide |
| SMILES | CN(C(=O)c1c(Br)n(C)c2ccccc12)C(C)(C)C |
| InChI | InChI=1S/C15H19BrN2O/c1-15(2,3)18(5)14(19)12-10-8-6-7-9-11(10)17(4)13(12)16/h6-9H,1-5H3 |
| InChIKey | LQFSFDNVFLFBJV-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.23 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |