C9H13F3O4S — CID 101108833
[(1S,5S)-5-(2,2,2-trifluoroethoxy)cyclopent-2-en-1-yl]methyl methanesulfonate (PubChem CID 101108833) has the molecular formula C9H13F3O4S and a molecular weight of 274.26 g/mol. Its IUPAC name is [(1S,5S)-5-(2,2,2-trifluoroethoxy)cyclopent-2-en-1-yl]methyl methanesulfonate.
| Compound Name | [(1S,5S)-5-(2,2,2-trifluoroethoxy)cyclopent-2-en-1-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 101108833 |
| Molecular Formula | C9H13F3O4S |
| Molecular Weight | 274.26 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | [(1S,5S)-5-(2,2,2-trifluoroethoxy)cyclopent-2-en-1-yl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OC[C@@H]1C=CC[C@@H]1OCC(F)(F)F |
| InChI | InChI=1S/C9H13F3O4S/c1-17(13,14)16-5-7-3-2-4-8(7)15-6-9(10,11)12/h2-3,7-8H,4-6H2,1H3/t7-,8-/m0/s1 |
| InChIKey | GWLLXUVZMGVJPG-YUMQZZPRSA-N |
| XLogP | 1.49 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.26 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|