About [(1S,5R)-5-ethoxycyclopent-2-en-1-yl]methyl methanesulfonate
[(1S,5R)-5-ethoxycyclopent-2-en-1-yl]methyl methanesulfonate (PubChem CID 101108834) has the molecular formula C9H16O4S
and a molecular weight of 220.29 g/mol. Its IUPAC name is [(1S,5R)-5-ethoxycyclopent-2-en-1-yl]methyl methanesulfonate.
Molecular Properties
| Compound Name | [(1S,5R)-5-ethoxycyclopent-2-en-1-yl]methyl methanesulfonate |
| PubChem CID | 101108834 |
| Molecular Formula | C9H16O4S |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | [(1S,5R)-5-ethoxycyclopent-2-en-1-yl]methyl methanesulfonate |
| SMILES | CCO[C@@H]1CC=C[C@H]1COS(C)(=O)=O |
| InChI | InChI=1S/C9H16O4S/c1-3-12-9-6-4-5-8(9)7-13-14(2,10)11/h4-5,8-9H,3,6-7H2,1-2H3/t8-,9+/m0/s1 |
| InChIKey | KCAGBXVFLWDLLU-DTWKUNHWSA-N |
| XLogP | 0.94 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [(1S,5R)-5-ethoxycyclopent-2-en-1-yl]methyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,5R)-5-ethoxycyclopent-2-en-1-yl]methyl methanesulfonate?
The IUPAC name of [(1S,5R)-5-ethoxycyclopent-2-en-1-yl]methyl methanesulfonate (CID 101108834) is [(1S,5R)-5-ethoxycyclopent-2-en-1-yl]methyl methanesulfonate.
What is the SMILES notation for [(1S,5R)-5-ethoxycyclopent-2-en-1-yl]methyl methanesulfonate?
The canonical SMILES for [(1S,5R)-5-ethoxycyclopent-2-en-1-yl]methyl methanesulfonate is CCO[C@@H]1CC=C[C@H]1COS(C)(=O)=O.
What is the InChIKey of [(1S,5R)-5-ethoxycyclopent-2-en-1-yl]methyl methanesulfonate?
The InChIKey is KCAGBXVFLWDLLU-DTWKUNHWSA-N. The full InChI is InChI=1S/C9H16O4S/c1-3-12-9-6-4-5-8(9)7-13-14(2,10)11/h4-5,8-9H,3,6-7H2,1-2H3/t8-,9+/m0/s1.
What are the key properties of [(1S,5R)-5-ethoxycyclopent-2-en-1-yl]methyl methanesulfonate?
[(1S,5R)-5-ethoxycyclopent-2-en-1-yl]methyl methanesulfonate has a molecular weight of 220.29 g/mol, XLogP of 0.94, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,5R)-5-ethoxycyclopent-2-en-1-yl]methyl methanesulfonate is sourced from PubChem (CID 101108834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).