About CID 101108904
CID 101108904 (PubChem CID 101108904) has the molecular formula C7H9O
and a molecular weight of 109.15 g/mol.
Molecular Properties
| Compound Name | CID 101108904 |
| PubChem CID | 101108904 |
| Molecular Formula | C7H9O |
| Molecular Weight | 109.15 g/mol |
| Exact Mass | 109.07 |
| IUPAC Name | — |
| SMILES | CC1=CC=C[CH]C1O |
| InChI | InChI=1S/C7H9O/c1-6-4-2-3-5-7(6)8/h2-5,7-8H,1H3 |
| InChIKey | OWTOGVOCVIDVJV-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 109.15 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 101108904 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 101108904?
The IUPAC name of CID 101108904 (CID 101108904) is not available.
What is the SMILES notation for CID 101108904?
The canonical SMILES for CID 101108904 is CC1=CC=C[CH]C1O.
What is the InChIKey of CID 101108904?
The InChIKey is OWTOGVOCVIDVJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9O/c1-6-4-2-3-5-7(6)8/h2-5,7-8H,1H3.
What are the key properties of CID 101108904?
CID 101108904 has a molecular weight of 109.15 g/mol, XLogP of 1.07, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 101108904 is sourced from PubChem (CID 101108904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).