C26H47NO8 — CID 101109172
13-cyclohexyl-5,6-bis(2,2-dimethyl-1,3-dioxolan-4-yl)-1,4,7,10-tetraoxa-13-azacyclopentadecane (PubChem CID 101109172) has the molecular formula C26H47NO8 and a molecular weight of 501.66 g/mol. Its IUPAC name is 13-cyclohexyl-5,6-bis(2,2-dimethyl-1,3-dioxolan-4-yl)-1,4,7,10-tetraoxa-13-azacyclopentadecane.
| Compound Name | 13-cyclohexyl-5,6-bis(2,2-dimethyl-1,3-dioxolan-4-yl)-1,4,7,10-tetraoxa-13-azacyclopentadecane |
|---|---|
| PubChem CID | 101109172 |
| Molecular Formula | C26H47NO8 |
| Molecular Weight | 501.66 g/mol |
| Exact Mass | 501.33 |
| IUPAC Name | 13-cyclohexyl-5,6-bis(2,2-dimethyl-1,3-dioxolan-4-yl)-1,4,7,10-tetraoxa-13-azacyclopentadecane |
| SMILES | CC1(C)OCC(C2OCCOCCN(C3CCCCC3)CCOCCOC2C2COC(C)(C)O2)O1 |
| InChI | InChI=1S/C26H47NO8/c1-25(2)32-18-21(34-25)23-24(22-19-33-26(3,4)35-22)31-17-15-29-13-11-27(10-12-28-14-16-30-23)20-8-6-5-7-9-20/h20-24H,5-19H2,1-4H3 |
| InChIKey | DVBUXGNFLAWJKK-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 77.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.66 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |