C23H34O5 — CID 10110977
(3aR,4R,5R,6aS)-4-[(3R)-3-(oxan-2-yloxy)-5-phenylpentyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2,5-diol (PubChem CID 10110977) has the molecular formula C23H34O5 and a molecular weight of 390.52 g/mol. Its IUPAC name is (3aR,4R,5R,6aS)-4-[(3R)-3-(oxan-2-yloxy)-5-phenylpentyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2,5-diol.
| Compound Name | (3aR,4R,5R,6aS)-4-[(3R)-3-(oxan-2-yloxy)-5-phenylpentyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2,5-diol |
|---|---|
| PubChem CID | 10110977 |
| Molecular Formula | C23H34O5 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | (3aR,4R,5R,6aS)-4-[(3R)-3-(oxan-2-yloxy)-5-phenylpentyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2,5-diol |
| SMILES | OC1C[C@@H]2[C@@H](CC[C@H](CCc3ccccc3)OC3CCCCO3)[C@H](O)C[C@@H]2O1 |
| InChI | InChI=1S/C23H34O5/c24-20-15-21-19(14-22(25)28-21)18(20)12-11-17(27-23-8-4-5-13-26-23)10-9-16-6-2-1-3-7-16/h1-3,6-7,17-25H,4-5,8-15H2/t17-,18+,19+,20+,21-,22?,23?/m0/s1 |
| InChIKey | MBFOKLFJZHHHQN-CWXMQIGYSA-N |
| XLogP | 3.42 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |