C10H12N2O — CID 101110195
(5R)-2-formyl-1,3,4,5,6,7-hexahydroisoindole-5-carbonitrile (PubChem CID 101110195) has the molecular formula C10H12N2O and a molecular weight of 176.22 g/mol. Its IUPAC name is (5R)-2-formyl-1,3,4,5,6,7-hexahydroisoindole-5-carbonitrile.
| Compound Name | (5R)-2-formyl-1,3,4,5,6,7-hexahydroisoindole-5-carbonitrile |
|---|---|
| PubChem CID | 101110195 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | (5R)-2-formyl-1,3,4,5,6,7-hexahydroisoindole-5-carbonitrile |
| SMILES | N#C[C@@H]1CCC2=C(C1)CN(C=O)C2 |
| InChI | InChI=1S/C10H12N2O/c11-4-8-1-2-9-5-12(7-13)6-10(9)3-8/h7-8H,1-3,5-6H2/t8-/m1/s1 |
| InChIKey | CMKBEAPCAKHKHB-MRVPVSSYSA-N |
| XLogP | 1.08 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|