About 1-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]-6,7-dihydro-5H-indol-4-one
1-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]-6,7-dihydro-5H-indol-4-one (PubChem CID 10111025) has the molecular formula C21H24F3N3O
and a molecular weight of 391.44 g/mol. Its IUPAC name is 1-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]-6,7-dihydro-5H-indol-4-one.
Molecular Properties
| Compound Name | 1-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]-6,7-dihydro-5H-indol-4-one |
| PubChem CID | 10111025 |
| Molecular Formula | C21H24F3N3O |
| Molecular Weight | 391.44 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 1-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]-6,7-dihydro-5H-indol-4-one |
| SMILES | O=C1CCCc2c1ccn2CCN1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C21H24F3N3O/c22-21(23,24)16-3-1-4-17(15-16)26-12-9-25(10-13-26)11-14-27-8-7-18-19(27)5-2-6-20(18)28/h1,3-4,7-8,15H,2,5-6,9-14H2 |
| InChIKey | WKQDQXMXMUGIRP-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.44 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]-6,7-dihydro-5H-indol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]-6,7-dihydro-5H-indol-4-one?
The IUPAC name of 1-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]-6,7-dihydro-5H-indol-4-one (CID 10111025) is 1-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]-6,7-dihydro-5H-indol-4-one.
What is the SMILES notation for 1-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]-6,7-dihydro-5H-indol-4-one?
The canonical SMILES for 1-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]-6,7-dihydro-5H-indol-4-one is O=C1CCCc2c1ccn2CCN1CCN(c2cccc(C(F)(F)F)c2)CC1.
What is the InChIKey of 1-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]-6,7-dihydro-5H-indol-4-one?
The InChIKey is WKQDQXMXMUGIRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24F3N3O/c22-21(23,24)16-3-1-4-17(15-16)26-12-9-25(10-13-26)11-14-27-8-7-18-19(27)5-2-6-20(18)28/h1,3-4,7-8,15H,2,5-6,9-14H2.
What are the key properties of 1-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]-6,7-dihydro-5H-indol-4-one?
1-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]-6,7-dihydro-5H-indol-4-one has a molecular weight of 391.44 g/mol, XLogP of 3.85, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]-6,7-dihydro-5H-indol-4-one is sourced from PubChem (CID 10111025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).