C12H17NO2 — CID 101110415
(8aS)-5-pent-4-enyl-1,7,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyridin-3-one (PubChem CID 101110415) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is (8aS)-5-pent-4-enyl-1,7,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyridin-3-one.
| Compound Name | (8aS)-5-pent-4-enyl-1,7,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyridin-3-one |
|---|---|
| PubChem CID | 101110415 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | (8aS)-5-pent-4-enyl-1,7,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyridin-3-one |
| SMILES | C=CCCCC1=CCC[C@H]2COC(=O)N12 |
| InChI | InChI=1S/C12H17NO2/c1-2-3-4-6-10-7-5-8-11-9-15-12(14)13(10)11/h2,7,11H,1,3-6,8-9H2/t11-/m0/s1 |
| InChIKey | SKGMKOAZMMGLFY-NSHDSACASA-N |
| XLogP | 2.84 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|