C19H19N5O — CID 101110456
4-[2-(2,5,9,17-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),4,6,9,11,13,15-octaen-7-yl)ethyl]morpholine (PubChem CID 101110456) has the molecular formula C19H19N5O and a molecular weight of 333.39 g/mol. Its IUPAC name is 4-[2-(2,5,9,17-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),4,6,9,11,13,15-octaen-7-yl)ethyl]morpholine.
| Compound Name | 4-[2-(2,5,9,17-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),4,6,9,11,13,15-octaen-7-yl)ethyl]morpholine |
|---|---|
| PubChem CID | 101110456 |
| Molecular Formula | C19H19N5O |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 4-[2-(2,5,9,17-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),4,6,9,11,13,15-octaen-7-yl)ethyl]morpholine |
| SMILES | c1ccc2c(c1)[nH]c1nc3cncc(CCN4CCOCC4)c3nc12 |
| InChI | InChI=1S/C19H19N5O/c1-2-4-15-14(3-1)18-19(21-15)22-16-12-20-11-13(17(16)23-18)5-6-24-7-9-25-10-8-24/h1-4,11-12H,5-10H2,(H,21,22) |
| InChIKey | WYKGYWXRHZFKON-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |