C16H12FNO2S — CID 101110710
5-(4-fluorophenyl)-4-(4-methylsulfinylphenyl)-1,2-oxazole (PubChem CID 101110710) has the molecular formula C16H12FNO2S and a molecular weight of 301.34 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-4-(4-methylsulfinylphenyl)-1,2-oxazole.
| Compound Name | 5-(4-fluorophenyl)-4-(4-methylsulfinylphenyl)-1,2-oxazole |
|---|---|
| PubChem CID | 101110710 |
| Molecular Formula | C16H12FNO2S |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | 5-(4-fluorophenyl)-4-(4-methylsulfinylphenyl)-1,2-oxazole |
| SMILES | CS(=O)c1ccc(-c2cnoc2-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C16H12FNO2S/c1-21(19)14-8-4-11(5-9-14)15-10-18-20-16(15)12-2-6-13(17)7-3-12/h2-10H,1H3 |
| InChIKey | MIDVTWZPXZLERP-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |