About pyridin-2-ylmethyl 2-phenylpropanoate
pyridin-2-ylmethyl 2-phenylpropanoate (PubChem CID 101111026) has the molecular formula C15H15NO2
and a molecular weight of 241.29 g/mol. Its IUPAC name is pyridin-2-ylmethyl 2-phenylpropanoate.
Molecular Properties
| Compound Name | pyridin-2-ylmethyl 2-phenylpropanoate |
| PubChem CID | 101111026 |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | pyridin-2-ylmethyl 2-phenylpropanoate |
| SMILES | CC(C(=O)OCc1ccccn1)c1ccccc1 |
| InChI | InChI=1S/C15H15NO2/c1-12(13-7-3-2-4-8-13)15(17)18-11-14-9-5-6-10-16-14/h2-10,12H,11H2,1H3 |
| InChIKey | VWSMZAOBJCLTSC-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pyridin-2-ylmethyl 2-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-2-ylmethyl 2-phenylpropanoate?
The IUPAC name of pyridin-2-ylmethyl 2-phenylpropanoate (CID 101111026) is pyridin-2-ylmethyl 2-phenylpropanoate.
What is the SMILES notation for pyridin-2-ylmethyl 2-phenylpropanoate?
The canonical SMILES for pyridin-2-ylmethyl 2-phenylpropanoate is CC(C(=O)OCc1ccccn1)c1ccccc1.
What is the InChIKey of pyridin-2-ylmethyl 2-phenylpropanoate?
The InChIKey is VWSMZAOBJCLTSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO2/c1-12(13-7-3-2-4-8-13)15(17)18-11-14-9-5-6-10-16-14/h2-10,12H,11H2,1H3.
What are the key properties of pyridin-2-ylmethyl 2-phenylpropanoate?
pyridin-2-ylmethyl 2-phenylpropanoate has a molecular weight of 241.29 g/mol, XLogP of 2.93, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-2-ylmethyl 2-phenylpropanoate is sourced from PubChem (CID 101111026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).