C22H20N2O5 — CID 10111103
4,4-bis(5H-[1,3]dioxolo[4,5-f]indol-7-yl)butan-1-ol (PubChem CID 10111103) has the molecular formula C22H20N2O5 and a molecular weight of 392.41 g/mol. Its IUPAC name is 4,4-bis(5H-[1,3]dioxolo[4,5-f]indol-7-yl)butan-1-ol.
| Compound Name | 4,4-bis(5H-[1,3]dioxolo[4,5-f]indol-7-yl)butan-1-ol |
|---|---|
| PubChem CID | 10111103 |
| Molecular Formula | C22H20N2O5 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 4,4-bis(5H-[1,3]dioxolo[4,5-f]indol-7-yl)butan-1-ol |
| SMILES | OCCCC(c1c[nH]c2cc3c(cc12)OCO3)c1c[nH]c2cc3c(cc12)OCO3 |
| InChI | InChI=1S/C22H20N2O5/c25-3-1-2-12(15-8-23-17-6-21-19(4-13(15)17)26-10-28-21)16-9-24-18-7-22-20(5-14(16)18)27-11-29-22/h4-9,12,23-25H,1-3,10-11H2 |
| InChIKey | LCGCQDZRGRTDKV-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 88.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |