C8H10O3 — CID 101111052
(4Z)-4-(hydroxymethylidene)-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]furan-5-one (PubChem CID 101111052) has the molecular formula C8H10O3 and a molecular weight of 154.17 g/mol. Its IUPAC name is (4Z)-4-(hydroxymethylidene)-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]furan-5-one.
| Compound Name | (4Z)-4-(hydroxymethylidene)-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]furan-5-one |
|---|---|
| PubChem CID | 101111052 |
| Molecular Formula | C8H10O3 |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | (4Z)-4-(hydroxymethylidene)-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]furan-5-one |
| SMILES | O=C1CC2COCC2/C1=C/O |
| InChI | InChI=1S/C8H10O3/c9-2-6-7-4-11-3-5(7)1-8(6)10/h2,5,7,9H,1,3-4H2/b6-2- |
| InChIKey | XIALBDKBWGEYLJ-KXFIGUGUSA-N |
| XLogP | 0.66 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|