C13H20N4O7 — CID 101111212
7-hydroxy-6,7-dimethyl-8-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]-1H-pteridine-2,4-dione (PubChem CID 101111212) has the molecular formula C13H20N4O7 and a molecular weight of 344.32 g/mol. Its IUPAC name is 7-hydroxy-6,7-dimethyl-8-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]-1H-pteridine-2,4-dione.
| Compound Name | 7-hydroxy-6,7-dimethyl-8-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]-1H-pteridine-2,4-dione |
|---|---|
| PubChem CID | 101111212 |
| Molecular Formula | C13H20N4O7 |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 7-hydroxy-6,7-dimethyl-8-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]-1H-pteridine-2,4-dione |
| SMILES | CC1=Nc2c([nH]c(=O)[nH]c2=O)N(C[C@H](O)[C@H](O)[C@H](O)CO)C1(C)O |
| InChI | InChI=1S/C13H20N4O7/c1-5-13(2,24)17(3-6(19)9(21)7(20)4-18)10-8(14-5)11(22)16-12(23)15-10/h6-7,9,18-21,24H,3-4H2,1-2H3,(H2,15,16,22,23)/t6-,7+,9-,13?/m0/s1 |
| InChIKey | WOYAJPZYMUQBRF-LRZYSGDNSA-N |
| XLogP | -3.24 |
| TPSA | 182.47 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | -3.24 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |