C27H27NO4 — CID 101111220
methyl 2-[(3R,5R)-3,4-dibenzyl-2-oxo-5-phenylmorpholin-3-yl]acetate (PubChem CID 101111220) has the molecular formula C27H27NO4 and a molecular weight of 429.52 g/mol. Its IUPAC name is methyl 2-[(3R,5R)-3,4-dibenzyl-2-oxo-5-phenylmorpholin-3-yl]acetate.
| Compound Name | methyl 2-[(3R,5R)-3,4-dibenzyl-2-oxo-5-phenylmorpholin-3-yl]acetate |
|---|---|
| PubChem CID | 101111220 |
| Molecular Formula | C27H27NO4 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | methyl 2-[(3R,5R)-3,4-dibenzyl-2-oxo-5-phenylmorpholin-3-yl]acetate |
| SMILES | COC(=O)C[C@]1(Cc2ccccc2)C(=O)OC[C@@H](c2ccccc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C27H27NO4/c1-31-25(29)18-27(17-21-11-5-2-6-12-21)26(30)32-20-24(23-15-9-4-10-16-23)28(27)19-22-13-7-3-8-14-22/h2-16,24H,17-20H2,1H3/t24-,27+/m0/s1 |
| InChIKey | STKAEFLAZYQMSM-RPLLCQBOSA-N |
| XLogP | 4.33 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |