C24H25NO5 — CID 101111310
[(1S)-2-ethoxy-2-oxo-1-phenylethyl] (3aR,4S,9bS)-8-methoxy-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-4-carboxylate (PubChem CID 101111310) has the molecular formula C24H25NO5 and a molecular weight of 407.47 g/mol. Its IUPAC name is [(1S)-2-ethoxy-2-oxo-1-phenylethyl] (3aR,4S,9bS)-8-methoxy-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-4-carboxylate.
| Compound Name | [(1S)-2-ethoxy-2-oxo-1-phenylethyl] (3aR,4S,9bS)-8-methoxy-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 101111310 |
| Molecular Formula | C24H25NO5 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | [(1S)-2-ethoxy-2-oxo-1-phenylethyl] (3aR,4S,9bS)-8-methoxy-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-4-carboxylate |
| SMILES | CCOC(=O)[C@@H](OC(=O)[C@H]1Nc2ccc(OC)cc2[C@H]2C=CC[C@@H]12)c1ccccc1 |
| InChI | InChI=1S/C24H25NO5/c1-3-29-24(27)22(15-8-5-4-6-9-15)30-23(26)21-18-11-7-10-17(18)19-14-16(28-2)12-13-20(19)25-21/h4-10,12-14,17-18,21-22,25H,3,11H2,1-2H3/t17-,18+,21-,22-/m0/s1 |
| InChIKey | ABGOTGQGRDOTSX-UDKICSLYSA-N |
| XLogP | 4.00 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|